Concept explainers
The antipsychotic drug flupentixol is prepared by the following scheme:
a)
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The reaction is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The given compound (A) reacts with chloro propanol gives the compound (C).
The reaction is given below,
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
b)
Interpretation:
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The Grignard reagent is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The Grignard reagent is given below,
The compound (c) reaction with thionyl chloride gives chlorinated compound, then it is reacting with magnesium gives the Grignard reagent (D).
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
c)
Interpretation
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The pair of enantiomers is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The pair of enantiomers is given below,
The compound (D) reaction with compound (E) gives enantiomer of corresponding products.
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
d)
Interpretation:
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The compound (F) undergoes hydrolysis reaction gives E and Z isomers of corresponding products.
Explanation of Solution
Given information:
The given reactant shown below,
The compound (F) undergoes hydrolysis reaction gives E and Z isomers of corresponding products.
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
Want to see more full solutions like this?
Chapter 11 Solutions
Organic Chemistry
- Compound H (C8H6O3) gives a precipitate when treated with hydroxylamine in aqueous ethanol and a silver mirror when treated with Tollens solution. Following is its 1H-NMR spectrum. Deduce the structure of compound H.arrow_forwardFollowing is the structural formula of Surfynol, a defoaming surfactant. Describe the synthesis of this compound from acetylene and a ketone. How many stereoisomers are possible for Surfynol?arrow_forwardReaction of phenol with acetone in the presence of an acid catalyst gives a compound known as bisphenol A, which is used in the production of epoxy and polycarbonate resins (Section 29.5). Propose a mechanism for the formation of bisphenol Aarrow_forward
- An alkene is treated with OsO4 followed by H2O2. When the resulting diol is treated with HIO4, the only product obtained is an unsubstituted cyclic ketone with molecular formula C6H10O. What is the structure of the alkene?arrow_forwardDescribe how 3-methyl-1-phenyl-3-pentanol can be prepared from benzene. You can use any inorganic reagents and solvents, and any organic reagents provided they contain no more than two carbons.arrow_forwardDescribe how the following compounds could be prepared from cyclohexanone using an enamine intermediate:arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forwardShow how the following compounds can be prepared from benzene:arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forwardWhat product is obtained when the following compound undergoes two successive elimination reactions?arrow_forwardSynthesize the following compound from benzonitrile (C6H5CN):arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning