1) In the following reaction2NaOH + H2C204 ------->Na2C204 + 2H2On of moles of H2C204=2nb of moles ofNaOHnb of moles of NaOH = nb of moles of%3DH2C204nb of moles of NaOH= 2nb of moles ofH2C204

The question is based on the concept of Reaction Stoichiometry. We have to establish relation…

Answered: 1) In the following reaction 2NAOH +…

1) In the following reaction 2NAOH + H2C204 Na2C204 + 2H2O n of moles of H2C204=2nb of moles o NaOH nb of moles of NaOH = nb of moles of H2C204 nb of moles of NaOH= 2nb of moles of

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.88E

See similar textbooks

Related questions

Q: how many moles of chromium (III)oxide are produced if 2 moles of ammonium dichromate are used?…

A: Given Reaction (NH4)2Cr2O7 ------> Cr2O3 + 4H2O + N2 Given moles of ammonium dichromate = 2 we…

Q: ow many moles of ammonia would be required to react exactly with 0.366 moles of copper(II) oxide in…

A: Given : 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3 H₂O(g)

Q: 3H2 + N2 --> 2NH3 If you were to have 10moles of H2 and 4moles of N2, how many moles of NH3 could…

A: Firstly, find the limiting reagent in the given reaction & use stoichiometric calculation for to…

Q: How many moles of nitric acid, HNO₃, are needed to react with 2.56 moles of Cu in the following…

A: The answer of following question is given below.

Q: How many moles of ammonia would be required to react exactly with 0.754 moles of copper(II) oxide in…

A: Ammonia reacts with copper (II) oxide to form copper metal, nitrogen gas, and water. The equation…

Q: If 6.916.91 mol of C5H12C5H12 reacts with excess O2,O2, how many moles of CO2CO2 will be produced by…

A: The given reaction is as follows: C5H12 + 8O2 → 6H2O + 5CO2 The moles of C5H12 given = 6.91 mol The…

Q: Nitric oxide (NO) reacts with oxygen gas to form nitrogen dioxide (NO2 ), a dark-brown gas:…

Q: 3. For the unbalanced equation: Mg3N2 + H2O----------->Mg(OH)2 + NH3 How many moles of Mg(OH)2 are…

A: Given Mg3N2 + H2O -> Mg (OH)2 + NH3 Weight of water = 125 g moles of Mg (OH)2 formed = ?

Q: 2S(s) + 3O2(g) --> 2SO3(g) how many moles of SO3 can be produced from 7.2 g O2 and excess S?

A: The balanced reaction taking place is 2 S (s) + 3 O2 (g) --> 2 SO3 (g)

Q: How many moles of NH₃ can be produced from 4.98 moles of nitrogen in the following reaction: N₂ (g)…

A: Given :- N₂ (g) + 3 H₂ (g) → 2 NH₃ (g) No.of moles of N2 = 4.98 mol To calculate :- No.of moles…

Q: Given the reaction below: 6 A --> 2 B + 5 C How many moles of B can be formed by the complete…

A: Welcome to bartleby ! Introduction : We have to calculate moles of B

Q: 11. The combustion of glucose is represented by the following balanced equation: C6 H1206+6 02 6…

A: Limiting reagent: The reagent that consumed completely during course of reaction is known as…

Q: 5. CgH1s O2- CO2 + H20 Balanced Equation: O2 to H20 CO, to O2 Mole Ratio of CaH8 to CO2 H2O to CgHi3…

A: Balanced chemical equation means the number of atoms of each kind must be equal on both sides of the…

Q: 3H2 + N2 --> 2NH3 If you were to have 9moles of H2 and 20moles of N2, what would be the limiting…

A: A

Q: If 0.249 moles of fluorine react completely with excess nitrogen, how many moles of nitrogen…

Q: C6H8 + O2 ------à CO2 + H2O How many moles of O2 are needed to form 60…

Q: If 0.35 moles of KIO3 are contained in a beaker with excess I^- and excess H^+, how many moles of…

A: Interpretation - To determine the mole of S2O32- are needed to react with all of the I2 formed when…

Q: How many moles of KBrO3 are required to prepare :0.0700 moles of Br2 according to the reaction KBRO3…

A: Calculate the moles of KBrO3 required in the given reaction---

Q: How many moles of NH₃ can be produced from 2.02 moles of nitrogen in the following reaction: N₂…

A: Balanced reaction is the reaction in which the number of atoms of reactants and products are equal.

Q: following unbalanced chemical reaction: C2H4Cl2 + NH3 → C2H8N2 + HCl If you mixed 3.5 moles…

Q: Consider the following reaction 2Al(OH)3+3H2SO4-->Al2(SO4)3+6H2O how many moles of H2O are formed…

Q: How many molecules of SO₃ can be formed from 0.56 moles of O₂

A: Given :- unbalanced equation SO₂(g) + O₂(g) → SO₃(g) Number of moles of O2 = 0.56…

Q: How many moles of ammonia would be required to react exactly with 0.470 moles of copper II oxide in…

A: The balanced reaction taking place is given as, => 2 NH3 (g) + 3 CuO (s) → 3 Cu (s) + N2 (g) + 3…

Q: What is the mole to mole ratio between oxygen and carbon dioxide in the following equation which…

A: Given, The combustion reaction of propane is given as following,C3H8(g)+5O2(g)→3CO2(g)+4H2O(l)we are…

Q: For the balanced chemical reaction C3H8 + 5O2 → 3CO2 + 4H2O how many moles of O2 are needed to…

Q: When the following equation is balanced, the coefficient in front of H2O is _____ H2SO4 + _____…

A: The given unbalanced chemical equation is H2SO4 + B(OH)3 →B2(SO4)3+H2O. To find the coefficient in…

Q: What is the mass in grams of NO that can be formed from 3.22 moles of NO2 in the reaction below?…

A: The answer is given as follows

Q: How many moles of H2O can be formed from 2.26x1023 molecules of NH3 from the following equation?…

A: According to the mole concept, in terms of mass, the amount of substance in moles is equal to the…

Q: 3H2 + N2 --> 2NH3 If you were to have 12moles of H2 and 3moles of N2, what would be the limiting…

A: The balanced reaction taking place is given, => 3 H2 + N2 ------> 2 NH3 Given : Moles of H2…

Q: What is the percent yeild of the reaction when 20.0 g of ethane reacts with excess oxygen to…

A: No of moles of ethane = Mass/Molar mass of ethane = 20.0g/(30.07gmol-1) = 0.665 moles

Q: Given the following Reaction: 2C5H10O2 + 13O2 → 10CO2 + 10H2O

A: 2 C5H10O2 + 13 O2…

Q: moles

Q: Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide…

A: moles of octane = mass/ molecular mass = 2.3/114 = 0.0202 moles of oxygen = 3.2 / 32 = 0.1 Since…

Q: How many moles of NH₃ can be produced from 4.77 moles of nitrogen in the following reaction: N₂ (g)…

Q: 2. Nitric oxide (NO) reacts with oxygen gas to form nitrogen dioxide (NO2 ), a dark-brown gas:…

Q: In this reaction, how many moles of propane (C3H3) would react with 15 moles of 02? C3H3 + 50, –…

A: The answer to the following question is given as:

Q: how many moles of Ca3(PO4)2will be formed if 8.0 mole of each reactant is present?…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Use stoichiometry for the calculation of the moles of CO2 from the given equation.

Q: When 24 mol of methanol and 15 mol of oxygen combinein the combustion reaction 2 CH3OH1l2 + 3…

A: The answer to the following question is given as -

Q: How many moles of H2O can be formed from 3.64x1023 molecules of NH3 from the following equation?…

A: # We the relation between the moles of ammonia and water we can use that to calculate the moles of…

Q: moles of lithium nitride

Q: Given 2 CL2 + Ti ---> TiCl4, how many moles of products will be produced from 1,205.3 grams of…

Q: CH4+2H2O=CO2+4H2 What is the limiting reactant when 20g CH4 React with 15g H2O?

A: Limiting reagent is the reagent which is consumed in the chemical reaction completely. It decides…

Q: How many moles of ammonia would be required to react exactly with 0.584 moles of copper(II) oxide in…

A: Answer :- 0.389 mol NH3 The moles of ammonia will be required to react exactly with 0.584 moles of…

Q: The fizz produced when an Alka-Seltzer tablet is dissolved in water is due to the reaction between…

A: Limiting Reagent is the reactant which is consumed completely after the completion of the reaction.

Q: 2MNO4¯ + 5C2O4² +16 H* 2Mn+2 +10 C02 + 8H2O 2 moles of MnO4 reacted with 5 mole of…

Q: iven the following balanced equations, answer the following questions. C3H8O2 + 402 3CO2 + 4H2O What…

A: A chemical equation is the symbolic representation of a chemical reaction in the form of symbols and…

Q: 2H2(g)+O2(g)→2H2O(g) How many moles of H2 are needed to react with 5.0 moles of O2?

A: Number of moles is equal to the ratio of mass to molar mass. Number of moles=MassMolar mass Balanced…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Concept introduction: Number of moles of a substance is equal to the ratio of mass to molar mass.…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

1) In the following reaction
2NaOH + H2C204 -
------>
Na2C204 + 2H2O
n of moles of H2C204=2nb of moles of
NaOH
nb of moles of NaOH = nb of moles of
%3D
H2C204
nb of moles of NaOH= 2nb of moles of
H2C204

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
A 0.20 mol sample of magnesium burns in air to form 0.20 mol of solid MgO. What amount (moles) of oxygen (O2) is required for a complete reaction?
4-89 If 7.0 kg of is added to 11.0 kg of to form which reactant is in excess?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
For each of the following unbalanced reactions, suppose exactly 5.00 g of each reactant is taken. Determine which reactant is limiting, and also determine what mass of the excess reagent will remain after the limiting reactant is consumed. Na2B4O7(s) + H2SO4(o H3BOj(j) + Na2SO4(u CaC,(s) + H2O(/) Ca(OH)2(s) + C2H2(g) NaCl(s) + H2SO4(/> HCl(g) + Na2SO4(s) SiO2(s) + C(x) —> Si(/) + CO(g)
For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
On Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?